C33H45N3O5 — CID 134143389
ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(2-formylphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 134143389) has the molecular formula C33H45N3O5 and a molecular weight of 563.74 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(2-formylphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(2-formylphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 134143389 |
| Molecular Formula | C33H45N3O5 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S,14R,15R)-15-[[4-[(2-formylphenoxy)methyl]triazol-1-yl]methyl]-14-hydroxy-5,9,13-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)[C@H](Cn1cc(COc2ccccc2C=O)nn1)[C@H]4O |
| InChI | InChI=1S/C33H45N3O5/c1-5-40-29(39)32(4)14-8-13-31(3)26(32)12-16-33-21-30(2,15-11-27(31)33)28(38)24(33)18-36-17-23(34-35-36)20-41-25-10-7-6-9-22(25)19-37/h6-7,9-10,17,19,24,26-28,38H,5,8,11-16,18,20-21H2,1-4H3/t24-,26+,27+,28-,30+,31-,32-,33-/m1/s1 |
| InChIKey | GDAUNGDGGQMTMA-JCRLNXGFSA-N |
| XLogP | 5.62 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|