C21H28N4O2 — CID 134143470
ethyl 13-(cyclohexylamino)-3-methyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate (PubChem CID 134143470) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl 13-(cyclohexylamino)-3-methyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate.
| Compound Name | ethyl 13-(cyclohexylamino)-3-methyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 134143470 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | ethyl 13-(cyclohexylamino)-3-methyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1C)-c1nc(NC3CCCCC3)ncc1CCC2 |
| InChI | InChI=1S/C21H28N4O2/c1-3-27-20(26)17-12-14-8-7-9-15-13-22-21(23-16-10-5-4-6-11-16)24-18(15)19(14)25(17)2/h12-13,16H,3-11H2,1-2H3,(H,22,23,24) |
| InChIKey | DKZNMHIMSUIVIN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |