About 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole
6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole (PubChem CID 134143623) has the molecular formula C23H25ClF2N2O
and a molecular weight of 418.92 g/mol. Its IUPAC name is 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole.
Molecular Properties
| Compound Name | 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole |
| PubChem CID | 134143623 |
| Molecular Formula | C23H25ClF2N2O |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole |
| SMILES | COc1ccccc1CCC1CN(Cc2c[nH]c3cc(Cl)ccc23)CCC1(F)F |
| InChI | InChI=1S/C23H25ClF2N2O/c1-29-22-5-3-2-4-16(22)6-7-18-15-28(11-10-23(18,25)26)14-17-13-27-21-12-19(24)8-9-20(17)21/h2-5,8-9,12-13,18,27H,6-7,10-11,14-15H2,1H3 |
| InChIKey | OUZRJSBIXZKDFP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole?
The IUPAC name of 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole (CID 134143623) is 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole.
What is the SMILES notation for 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole?
The canonical SMILES for 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole is COc1ccccc1CCC1CN(Cc2c[nH]c3cc(Cl)ccc23)CCC1(F)F.
What is the InChIKey of 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole?
The InChIKey is OUZRJSBIXZKDFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25ClF2N2O/c1-29-22-5-3-2-4-16(22)6-7-18-15-28(11-10-23(18,25)26)14-17-13-27-21-12-19(24)8-9-20(17)21/h2-5,8-9,12-13,18,27H,6-7,10-11,14-15H2,1H3.
What are the key properties of 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole?
6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole has a molecular weight of 418.92 g/mol, XLogP of 5.92, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[[4,4-difluoro-3-[2-(2-methoxyphenyl)ethyl]piperidin-1-yl]methyl]-1H-indole is sourced from PubChem (CID 134143623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).