C20H24O4 — CID 134143715
prop-2-ynyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate (PubChem CID 134143715) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is prop-2-ynyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate.
| Compound Name | prop-2-ynyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 134143715 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | prop-2-ynyl (2R)-2-[(2R)-7-acetyloxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propanoate |
| SMILES | C#CCOC(=O)[C@H](C)[C@@H]1CCc2c(C)cc(OC(C)=O)c(C)c2C1 |
| InChI | InChI=1S/C20H24O4/c1-6-9-23-20(22)13(3)16-7-8-17-12(2)10-19(24-15(5)21)14(4)18(17)11-16/h1,10,13,16H,7-9,11H2,2-5H3/t13-,16-/m1/s1 |
| InChIKey | HWLSGOMBPXGVLD-CZUORRHYSA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|