C21H20F3N3O2 — CID 134143736
N-[1-(4-hydroxycyclohexyl)benzimidazol-2-yl]-3-(trifluoromethyl)benzamide (PubChem CID 134143736) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[1-(4-hydroxycyclohexyl)benzimidazol-2-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(4-hydroxycyclohexyl)benzimidazol-2-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 134143736 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[1-(4-hydroxycyclohexyl)benzimidazol-2-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc2ccccc2n1C1CCC(O)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F3N3O2/c22-21(23,24)14-5-3-4-13(12-14)19(29)26-20-25-17-6-1-2-7-18(17)27(20)15-8-10-16(28)11-9-15/h1-7,12,15-16,28H,8-11H2,(H,25,26,29) |
| InChIKey | IDJUAWMLSORTJP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |