C27H24F3N5O — CID 134143846
2-[2-[4-(3,5-dimethylpiperidin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1-benzofuran-6-carbonitrile (PubChem CID 134143846) has the molecular formula C27H24F3N5O and a molecular weight of 491.52 g/mol. Its IUPAC name is 2-[2-[4-(3,5-dimethylpiperidin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1-benzofuran-6-carbonitrile.
| Compound Name | 2-[2-[4-(3,5-dimethylpiperidin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1-benzofuran-6-carbonitrile |
|---|---|
| PubChem CID | 134143846 |
| Molecular Formula | C27H24F3N5O |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[2-[4-(3,5-dimethylpiperidin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1-benzofuran-6-carbonitrile |
| SMILES | CC1CC(C)CN(c2ccc(Nc3ncc(C(F)(F)F)c(-c4cc5ccc(C#N)cc5o4)n3)cc2)C1 |
| InChI | InChI=1S/C27H24F3N5O/c1-16-9-17(2)15-35(14-16)21-7-5-20(6-8-21)33-26-32-13-22(27(28,29)30)25(34-26)24-11-19-4-3-18(12-31)10-23(19)36-24/h3-8,10-11,13,16-17H,9,14-15H2,1-2H3,(H,32,33,34) |
| InChIKey | HIRAZOTVRKWBBH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|