C19H26N2O5S — CID 134144102
ethyl (2S,3aS,4E,8aS)-4-hydroxyimino-1-(4-methylphenyl)sulfonyl-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate (PubChem CID 134144102) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is ethyl (2S,3aS,4E,8aS)-4-hydroxyimino-1-(4-methylphenyl)sulfonyl-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2S,3aS,4E,8aS)-4-hydroxyimino-1-(4-methylphenyl)sulfonyl-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134144102 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | ethyl (2S,3aS,4E,8aS)-4-hydroxyimino-1-(4-methylphenyl)sulfonyl-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2/C(=N/O)CCCC[C@@H]2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H26N2O5S/c1-3-26-19(22)18-12-15-16(20-23)6-4-5-7-17(15)21(18)27(24,25)14-10-8-13(2)9-11-14/h8-11,15,17-18,23H,3-7,12H2,1-2H3/b20-16+/t15-,17+,18+/m1/s1 |
| InChIKey | QRBCNKOFCPHEHA-GBRBITTGSA-N |
| XLogP | 2.71 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|