About (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine
(Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine (PubChem CID 134144226) has the molecular formula C21H22N2O
and a molecular weight of 318.42 g/mol. Its IUPAC name is (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine.
Molecular Properties
| Compound Name | (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine |
| PubChem CID | 134144226 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine |
| SMILES | Cc1ccc(-n2c(C)cc(/C=N\OCc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C21H22N2O/c1-16-9-11-21(12-10-16)23-17(2)13-20(18(23)3)14-22-24-15-19-7-5-4-6-8-19/h4-14H,15H2,1-3H3/b22-14- |
| InChIKey | ZPNZRHANXRLBDB-HMAPJEAMSA-N |
| XLogP | 4.95 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine?
The IUPAC name of (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine (CID 134144226) is (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine.
What is the SMILES notation for (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine?
The canonical SMILES for (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine is Cc1ccc(-n2c(C)cc(/C=N\OCc3ccccc3)c2C)cc1.
What is the InChIKey of (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine?
The InChIKey is ZPNZRHANXRLBDB-HMAPJEAMSA-N. The full InChI is InChI=1S/C21H22N2O/c1-16-9-11-21(12-10-16)23-17(2)13-20(18(23)3)14-22-24-15-19-7-5-4-6-8-19/h4-14H,15H2,1-3H3/b22-14-.
What are the key properties of (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine?
(Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine has a molecular weight of 318.42 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-phenylmethoxymethanimine is sourced from PubChem (CID 134144226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).