C23H20ClN5O3S — CID 134144337
N-(5-chloropyrimidin-2-yl)-6-(4-morpholin-4-ylsulfonylphenyl)quinolin-4-amine (PubChem CID 134144337) has the molecular formula C23H20ClN5O3S and a molecular weight of 481.97 g/mol. Its IUPAC name is N-(5-chloropyrimidin-2-yl)-6-(4-morpholin-4-ylsulfonylphenyl)quinolin-4-amine.
| Compound Name | N-(5-chloropyrimidin-2-yl)-6-(4-morpholin-4-ylsulfonylphenyl)quinolin-4-amine |
|---|---|
| PubChem CID | 134144337 |
| Molecular Formula | C23H20ClN5O3S |
| Molecular Weight | 481.97 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-(5-chloropyrimidin-2-yl)-6-(4-morpholin-4-ylsulfonylphenyl)quinolin-4-amine |
| SMILES | O=S(=O)(c1ccc(-c2ccc3nccc(Nc4ncc(Cl)cn4)c3c2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C23H20ClN5O3S/c24-18-14-26-23(27-15-18)28-22-7-8-25-21-6-3-17(13-20(21)22)16-1-4-19(5-2-16)33(30,31)29-9-11-32-12-10-29/h1-8,13-15H,9-12H2,(H,25,26,27,28) |
| InChIKey | QQORJONSENOSNM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |