About (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one
(3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one (PubChem CID 134144370) has the molecular formula C23H27NO5
and a molecular weight of 397.47 g/mol. Its IUPAC name is (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one.
Molecular Properties
| Compound Name | (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one |
| PubChem CID | 134144370 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one |
| SMILES | CCN(CC)Cc1c(O)cccc1/C=C1\COc2cc(OC)c(OC)cc2C1=O |
| InChI | InChI=1S/C23H27NO5/c1-5-24(6-2)13-18-15(8-7-9-19(18)25)10-16-14-29-20-12-22(28-4)21(27-3)11-17(20)23(16)26/h7-12,25H,5-6,13-14H2,1-4H3/b16-10+ |
| InChIKey | MBCXELJBKPVSPV-MHWRWJLKSA-N |
| XLogP | 3.91 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one?
The IUPAC name of (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one (CID 134144370) is (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one.
What is the SMILES notation for (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one?
The canonical SMILES for (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one is CCN(CC)Cc1c(O)cccc1/C=C1\COc2cc(OC)c(OC)cc2C1=O.
What is the InChIKey of (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one?
The InChIKey is MBCXELJBKPVSPV-MHWRWJLKSA-N. The full InChI is InChI=1S/C23H27NO5/c1-5-24(6-2)13-18-15(8-7-9-19(18)25)10-16-14-29-20-12-22(28-4)21(27-3)11-17(20)23(16)26/h7-12,25H,5-6,13-14H2,1-4H3/b16-10+.
What are the key properties of (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one?
(3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one has a molecular weight of 397.47 g/mol, XLogP of 3.91, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[[2-(diethylaminomethyl)-3-hydroxyphenyl]methylidene]-6,7-dimethoxychromen-4-one is sourced from PubChem (CID 134144370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).