C22H28N2 — CID 134144504
(1R,12R,13S,17R,21S)-12-ethyl-18-methyl-10,18-diazapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10-pentaene (PubChem CID 134144504) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (1R,12R,13S,17R,21S)-12-ethyl-18-methyl-10,18-diazapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10-pentaene.
| Compound Name | (1R,12R,13S,17R,21S)-12-ethyl-18-methyl-10,18-diazapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 134144504 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (1R,12R,13S,17R,21S)-12-ethyl-18-methyl-10,18-diazapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10-pentaene |
| SMILES | CC[C@H]1c2nc3ccccc3cc2[C@@H]2CCN(C)[C@@H]3CCC[C@H]1[C@H]32 |
| InChI | InChI=1S/C22H28N2/c1-3-15-16-8-6-10-20-21(16)17(11-12-24(20)2)18-13-14-7-4-5-9-19(14)23-22(15)18/h4-5,7,9,13,15-17,20-21H,3,6,8,10-12H2,1-2H3/t15-,16-,17+,20-,21+/m1/s1 |
| InChIKey | KEJODPUXDHGKCO-ZUKOONMSSA-N |
| XLogP | 4.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |