C30H30O6 — CID 134144690
(1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2,3-dimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 134144690) has the molecular formula C30H30O6 and a molecular weight of 486.56 g/mol. Its IUPAC name is (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2,3-dimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2,3-dimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 134144690 |
| Molecular Formula | C30H30O6 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2,3-dimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)/C=C/c2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C30H30O6/c1-32-25-16-10-21(11-17-25)9-12-23-19-26(33-2)20-29(35-4)27(23)18-15-24(31)14-13-22-7-6-8-28(34-3)30(22)36-5/h6-20H,1-5H3/b12-9+,14-13+,18-15+ |
| InChIKey | OYCATIZZSASXBV-ASTIXQHPSA-N |
| XLogP | 6.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|