C25H34O6 — CID 134144861
6-[(5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]hexanoic acid (PubChem CID 134144861) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 6-[(5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]hexanoic acid.
| Compound Name | 6-[(5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 134144861 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 6-[(5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCC1=CC[C@@H]2[C@@H](/C=C/[C@@H](O)COc3ccccc3)[C@H](O)C[C@@H]2OC1 |
| InChI | InChI=1S/C25H34O6/c26-19(17-30-20-8-4-2-5-9-20)12-14-21-22-13-11-18(7-3-1-6-10-25(28)29)16-31-24(22)15-23(21)27/h2,4-5,8-9,11-12,14,19,21-24,26-27H,1,3,6-7,10,13,15-17H2,(H,28,29)/b14-12+/t19-,21-,22-,23-,24+/m1/s1 |
| InChIKey | MNMBYWCWGTYZOH-KKFXVKMKSA-N |
| XLogP | 3.73 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|