About Tetrabutylammonium fluorosulfate
Tetrabutylammonium fluorosulfate (PubChem CID 13414498) has the molecular formula C16H36FNO3S
and a molecular weight of 341.53 g/mol.
Molecular Properties
| Compound Name | Tetrabutylammonium fluorosulfate |
| PubChem CID | 13414498 |
| Molecular Formula | C16H36FNO3S |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | — |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])F |
| InChI | InChI=1S/C16H36N.FHO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H,2,3,4)/q+1;/p-1 |
| InChIKey | OGVMFPTXLRFNIQ-UHFFFAOYSA-M |
| XLogP | 4.42 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze Tetrabutylammonium fluorosulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tetrabutylammonium fluorosulfate?
The IUPAC name of Tetrabutylammonium fluorosulfate (CID 13414498) is not available.
What is the SMILES notation for Tetrabutylammonium fluorosulfate?
The canonical SMILES for Tetrabutylammonium fluorosulfate is CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])F.
What is the InChIKey of Tetrabutylammonium fluorosulfate?
The InChIKey is OGVMFPTXLRFNIQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.FHO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H,2,3,4)/q+1;/p-1.
What are the key properties of Tetrabutylammonium fluorosulfate?
Tetrabutylammonium fluorosulfate has a molecular weight of 341.53 g/mol, XLogP of 4.42, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Tetrabutylammonium fluorosulfate is sourced from PubChem (CID 13414498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).