C25H30N2O3 — CID 134145141
(8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-N-(6-methyl-3-pyridinyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 134145141) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-N-(6-methyl-3-pyridinyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-N-(6-methyl-3-pyridinyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 134145141 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-11,17-dihydroxy-13-methyl-N-(6-methyl-3-pyridinyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(c2)CC[C@@H]2[C@@H]3[C@@H](O)C[C@]3(C)[C@@H](O)CC[C@@H]23)cn1 |
| InChI | InChI=1S/C25H30N2O3/c1-14-3-6-17(13-26-14)27-24(30)16-5-7-18-15(11-16)4-8-19-20-9-10-22(29)25(20,2)12-21(28)23(18)19/h3,5-7,11,13,19-23,28-29H,4,8-10,12H2,1-2H3,(H,27,30)/t19-,20-,21-,22-,23+,25-/m0/s1 |
| InChIKey | XHOQUWOASSCOOG-FIIJTSBOSA-N |
| XLogP | 3.83 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |