C17H16N2O4 — CID 134145196
(2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]imidazo[1,2-a]pyridin-3-one (PubChem CID 134145196) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]imidazo[1,2-a]pyridin-3-one.
| Compound Name | (2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]imidazo[1,2-a]pyridin-3-one |
|---|---|
| PubChem CID | 134145196 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2Z)-2-[(3,4,5-trimethoxyphenyl)methylidene]imidazo[1,2-a]pyridin-3-one |
| SMILES | COc1cc(/C=C2\N=C3C=CC=CN3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H16N2O4/c1-21-13-9-11(10-14(22-2)16(13)23-3)8-12-17(20)19-7-5-4-6-15(19)18-12/h4-10H,1-3H3/b12-8- |
| InChIKey | RJQWQFZRUSDKDK-WQLSENKSSA-N |
| XLogP | 2.38 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|