C21H35N — CID 134145447
(3S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-amine (PubChem CID 134145447) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (3S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-amine.
| Compound Name | (3S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 134145447 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (3S,8R,9S,10S,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-amine |
| SMILES | C/C=C1/CC[C@H]2[C@@H]3CCC4C[C@@H](N)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H35N/c1-4-14-6-8-18-17-7-5-15-13-16(22)9-11-21(15,3)19(17)10-12-20(14,18)2/h4,15-19H,5-13,22H2,1-3H3/b14-4-/t15?,16-,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | WAGHQJXHHYRXFF-LTLXZZEISA-N |
| XLogP | 5.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|