C28H34N4O3 — CID 134145749
ethyl 13-(cyclohexylamino)-3-[(4-methoxyphenyl)methyl]-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate (PubChem CID 134145749) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is ethyl 13-(cyclohexylamino)-3-[(4-methoxyphenyl)methyl]-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate.
| Compound Name | ethyl 13-(cyclohexylamino)-3-[(4-methoxyphenyl)methyl]-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 134145749 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | ethyl 13-(cyclohexylamino)-3-[(4-methoxyphenyl)methyl]-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1Cc1ccc(OC)cc1)-c1nc(NC3CCCCC3)ncc1CCC2 |
| InChI | InChI=1S/C28H34N4O3/c1-3-35-27(33)24-16-20-8-7-9-21-17-29-28(30-22-10-5-4-6-11-22)31-25(21)26(20)32(24)18-19-12-14-23(34-2)15-13-19/h12-17,22H,3-11,18H2,1-2H3,(H,29,30,31) |
| InChIKey | ZUNVAXNBOZZTFV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |