About [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate
[2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate (PubChem CID 134145812) has the molecular formula C19H14Br2ClNO5
and a molecular weight of 531.58 g/mol. Its IUPAC name is [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate.
Molecular Properties
| Compound Name | [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate |
| PubChem CID | 134145812 |
| Molecular Formula | C19H14Br2ClNO5 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 528.89 |
| IUPAC Name | [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(Cc1cc(Br)cc(Br)c1OC(=O)c1ccccc1Cl)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C19H14Br2ClNO5/c20-11-7-10(8-16(24)23-15-5-6-27-19(15)26)17(13(21)9-11)28-18(25)12-3-1-2-4-14(12)22/h1-4,7,9,15H,5-6,8H2,(H,23,24)/t15-/m0/s1 |
| InChIKey | ZHQXNINTRUEQJP-HNNXBMFYSA-N |
| XLogP | 4.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate?
The IUPAC name of [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate (CID 134145812) is [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate.
What is the SMILES notation for [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate?
The canonical SMILES for [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate is O=C(Cc1cc(Br)cc(Br)c1OC(=O)c1ccccc1Cl)N[C@H]1CCOC1=O.
What is the InChIKey of [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate?
The InChIKey is ZHQXNINTRUEQJP-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H14Br2ClNO5/c20-11-7-10(8-16(24)23-15-5-6-27-19(15)26)17(13(21)9-11)28-18(25)12-3-1-2-4-14(12)22/h1-4,7,9,15H,5-6,8H2,(H,23,24)/t15-/m0/s1.
What are the key properties of [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate?
[2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate has a molecular weight of 531.58 g/mol, XLogP of 4.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dibromo-6-[2-oxo-2-[[(3S)-2-oxooxolan-3-yl]amino]ethyl]phenyl] 2-chlorobenzoate is sourced from PubChem (CID 134145812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).