C24H18N6OS — CID 134145841
2-(5-phenyl-4-pyridin-4-yltriazol-1-yl)-N-(5-thiophen-2-yl-2-pyridinyl)acetamide (PubChem CID 134145841) has the molecular formula C24H18N6OS and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-(5-phenyl-4-pyridin-4-yltriazol-1-yl)-N-(5-thiophen-2-yl-2-pyridinyl)acetamide.
| Compound Name | 2-(5-phenyl-4-pyridin-4-yltriazol-1-yl)-N-(5-thiophen-2-yl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 134145841 |
| Molecular Formula | C24H18N6OS |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-(5-phenyl-4-pyridin-4-yltriazol-1-yl)-N-(5-thiophen-2-yl-2-pyridinyl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccncc2)c1-c1ccccc1)Nc1ccc(-c2cccs2)cn1 |
| InChI | InChI=1S/C24H18N6OS/c31-22(27-21-9-8-19(15-26-21)20-7-4-14-32-20)16-30-24(18-5-2-1-3-6-18)23(28-29-30)17-10-12-25-13-11-17/h1-15H,16H2,(H,26,27,31) |
| InChIKey | RRSFKLUPJQWKGK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |