C18H22N2O4 — CID 134145978
5-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]pentanehydrazide (PubChem CID 134145978) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]pentanehydrazide.
| Compound Name | 5-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]pentanehydrazide |
|---|---|
| PubChem CID | 134145978 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-phenyl-N'-[(2,3,4-trihydroxyphenyl)methyl]pentanehydrazide |
| SMILES | O=C(CCCCc1ccccc1)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C18H22N2O4/c21-15-11-10-14(17(23)18(15)24)12-19-20-16(22)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,10-11,19,21,23-24H,4-5,8-9,12H2,(H,20,22) |
| InChIKey | CQOBRJZTCBMPTI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|