About N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide
N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide (PubChem CID 134146052) has the molecular formula C25H24N2O6
and a molecular weight of 448.48 g/mol. Its IUPAC name is N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide |
| PubChem CID | 134146052 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(C(=O)/C=C/c3ccc(OC)c(OC)c3OC)cc2)ccn1 |
| InChI | InChI=1S/C25H24N2O6/c1-26-25(29)20-15-19(13-14-27-20)33-18-9-5-16(6-10-18)21(28)11-7-17-8-12-22(30-2)24(32-4)23(17)31-3/h5-15H,1-4H3,(H,26,29)/b11-7+ |
| InChIKey | TWFUYDYDPJYQDI-YRNVUSSQSA-N |
| XLogP | 4.16 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide?
The IUPAC name of N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide (CID 134146052) is N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide.
What is the SMILES notation for N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide?
The canonical SMILES for N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide is CNC(=O)c1cc(Oc2ccc(C(=O)/C=C/c3ccc(OC)c(OC)c3OC)cc2)ccn1.
What is the InChIKey of N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide?
The InChIKey is TWFUYDYDPJYQDI-YRNVUSSQSA-N. The full InChI is InChI=1S/C25H24N2O6/c1-26-25(29)20-15-19(13-14-27-20)33-18-9-5-16(6-10-18)21(28)11-7-17-8-12-22(30-2)24(32-4)23(17)31-3/h5-15H,1-4H3,(H,26,29)/b11-7+.
What are the key properties of N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide?
N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide has a molecular weight of 448.48 g/mol, XLogP of 4.16, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenoxy]pyridine-2-carboxamide is sourced from PubChem (CID 134146052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).