About 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide
4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 134146168) has the molecular formula C22H16Cl2N2O3
and a molecular weight of 427.29 g/mol. Its IUPAC name is 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide |
| PubChem CID | 134146168 |
| Molecular Formula | C22H16Cl2N2O3 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(C(=O)/C=C/c3ccc(Cl)c(Cl)c3)cc2)ccn1 |
| InChI | InChI=1S/C22H16Cl2N2O3/c1-25-22(28)20-13-17(10-11-26-20)29-16-6-4-15(5-7-16)21(27)9-3-14-2-8-18(23)19(24)12-14/h2-13H,1H3,(H,25,28)/b9-3+ |
| InChIKey | CYVZAORPKHNHPV-YCRREMRBSA-N |
| XLogP | 5.44 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide?
The IUPAC name of 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide (CID 134146168) is 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide.
What is the SMILES notation for 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide?
The canonical SMILES for 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide is CNC(=O)c1cc(Oc2ccc(C(=O)/C=C/c3ccc(Cl)c(Cl)c3)cc2)ccn1.
What is the InChIKey of 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide?
The InChIKey is CYVZAORPKHNHPV-YCRREMRBSA-N. The full InChI is InChI=1S/C22H16Cl2N2O3/c1-25-22(28)20-13-17(10-11-26-20)29-16-6-4-15(5-7-16)21(27)9-3-14-2-8-18(23)19(24)12-14/h2-13H,1H3,(H,25,28)/b9-3+.
What are the key properties of 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide?
4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide has a molecular weight of 427.29 g/mol, XLogP of 5.44, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]-N-methylpyridine-2-carboxamide is sourced from PubChem (CID 134146168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).