About 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea
1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 134146307) has the molecular formula C24H20F3N5O3
and a molecular weight of 483.45 g/mol. Its IUPAC name is 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| PubChem CID | 134146307 |
| Molecular Formula | C24H20F3N5O3 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | COc1cc(Nc2ncnc3c(NC(=O)Nc4ccc(C(F)(F)F)cc4)cccc23)cc(OC)c1 |
| InChI | InChI=1S/C24H20F3N5O3/c1-34-17-10-16(11-18(12-17)35-2)30-22-19-4-3-5-20(21(19)28-13-29-22)32-23(33)31-15-8-6-14(7-9-15)24(25,26)27/h3-13H,1-2H3,(H,28,29,30)(H2,31,32,33) |
| InChIKey | RKVBCPRFFUIUTI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea (CID 134146307) is 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea is COc1cc(Nc2ncnc3c(NC(=O)Nc4ccc(C(F)(F)F)cc4)cccc23)cc(OC)c1.
What is the InChIKey of 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea?
The InChIKey is RKVBCPRFFUIUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F3N5O3/c1-34-17-10-16(11-18(12-17)35-2)30-22-19-4-3-5-20(21(19)28-13-29-22)32-23(33)31-15-8-6-14(7-9-15)24(25,26)27/h3-13H,1-2H3,(H,28,29,30)(H2,31,32,33).
What are the key properties of 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea?
1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea has a molecular weight of 483.45 g/mol, XLogP of 6.05, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,5-dimethoxyanilino)quinazolin-8-yl]-3-[4-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 134146307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).