C17H20ClFO2 — CID 134146494
(4aR,8R,8aR)-2-(4-chlorophenyl)-4-fluoro-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromen-8-ol (PubChem CID 134146494) has the molecular formula C17H20ClFO2 and a molecular weight of 310.80 g/mol. Its IUPAC name is (4aR,8R,8aR)-2-(4-chlorophenyl)-4-fluoro-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromen-8-ol.
| Compound Name | (4aR,8R,8aR)-2-(4-chlorophenyl)-4-fluoro-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromen-8-ol |
|---|---|
| PubChem CID | 134146494 |
| Molecular Formula | C17H20ClFO2 |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (4aR,8R,8aR)-2-(4-chlorophenyl)-4-fluoro-4,7-dimethyl-2,3,4a,5,8,8a-hexahydrochromen-8-ol |
| SMILES | CC1=CC[C@@H]2[C@@H](OC(c3ccc(Cl)cc3)CC2(C)F)[C@@H]1O |
| InChI | InChI=1S/C17H20ClFO2/c1-10-3-8-13-16(15(10)20)21-14(9-17(13,2)19)11-4-6-12(18)7-5-11/h3-7,13-16,20H,8-9H2,1-2H3/t13-,14?,15-,16-,17?/m1/s1 |
| InChIKey | QDVHAACJDCZJOV-OWUKFGMTSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|