C13H19NO5 — CID 134146563
(3aR,4R,7S,7aR)-3a-(hydroxymethyl)-2-(3-hydroxypropyl)-7a-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 134146563) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (3aR,4R,7S,7aR)-3a-(hydroxymethyl)-2-(3-hydroxypropyl)-7a-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7S,7aR)-3a-(hydroxymethyl)-2-(3-hydroxypropyl)-7a-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 134146563 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (3aR,4R,7S,7aR)-3a-(hydroxymethyl)-2-(3-hydroxypropyl)-7a-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@@]12C(=O)N(CCCO)C(=O)[C@]1(CO)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C13H19NO5/c1-12-8-3-4-9(19-8)13(12,7-16)11(18)14(10(12)17)5-2-6-15/h8-9,15-16H,2-7H2,1H3/t8-,9+,12+,13-/m0/s1 |
| InChIKey | AZOMVCDNZWBGSJ-ZFWZSOMGSA-N |
| XLogP | -0.72 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|