About 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea
1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea (PubChem CID 134147045) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea.
Molecular Properties
| Compound Name | 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea |
| PubChem CID | 134147045 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea |
| SMILES | N/C(=N\O)c1ccc(NC(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N4O2/c17-15(20-22)13-6-8-14(9-7-13)19-16(21)18-11-10-12-4-2-1-3-5-12/h1-9,22H,10-11H2,(H2,17,20)(H2,18,19,21) |
| InChIKey | JXKAQTGZACRJMM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea?
The IUPAC name of 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea (CID 134147045) is 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea.
What is the SMILES notation for 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea?
The canonical SMILES for 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea is N/C(=N\O)c1ccc(NC(=O)NCCc2ccccc2)cc1.
What is the InChIKey of 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea?
The InChIKey is JXKAQTGZACRJMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2/c17-15(20-22)13-6-8-14(9-7-13)19-16(21)18-11-10-12-4-2-1-3-5-12/h1-9,22H,10-11H2,(H2,17,20)(H2,18,19,21).
What are the key properties of 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea?
1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea has a molecular weight of 298.35 g/mol, XLogP of 2.15, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-3-(2-phenylethyl)urea is sourced from PubChem (CID 134147045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).