C22H28Cl2N2OS — CID 134147133
1-[4-[2-[Bis(3-chlorophenyl)methylsulfanyl]ethyl]piperazin-1-yl]propan-2-ol (PubChem CID 134147133) has the molecular formula C22H28Cl2N2OS and a molecular weight of 439.40 g/mol. Its IUPAC name is 1-[4-[2-[bis(3-chlorophenyl)methylsulfanyl]ethyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[4-[2-[Bis(3-chlorophenyl)methylsulfanyl]ethyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 134147133 |
| Molecular Formula | C22H28Cl2N2OS |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-[4-[2-[bis(3-chlorophenyl)methylsulfanyl]ethyl]piperazin-1-yl]propan-2-ol |
| SMILES | CC(CN1CCN(CC1)CCSC(C2=CC(=CC=C2)Cl)C3=CC(=CC=C3)Cl)O |
| InChI | InChI=1S/C22H28Cl2N2OS/c1-17(27)16-26-10-8-25(9-11-26)12-13-28-22(18-4-2-6-20(23)14-18)19-5-3-7-21(24)15-19/h2-7,14-15,17,22,27H,8-13,16H2,1H3 |
| InChIKey | KQOYJPPZVJXGGF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | 428 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |