C21H21NO4 — CID 134147487
(1E,4Z,6E)-5-(2-hydroxyethylamino)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 134147487) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (1E,4Z,6E)-5-(2-hydroxyethylamino)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-(2-hydroxyethylamino)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 134147487 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (1E,4Z,6E)-5-(2-hydroxyethylamino)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | O=C(/C=C(/C=C/c1ccc(O)cc1)NCCO)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C21H21NO4/c23-14-13-22-18(7-1-16-2-8-19(24)9-3-16)15-21(26)12-6-17-4-10-20(25)11-5-17/h1-12,15,22-25H,13-14H2/b7-1+,12-6+,18-15- |
| InChIKey | HRQCUINNRCYEAX-JKTVCNJXSA-N |
| XLogP | 2.86 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|