C19H19NO2S — CID 134147536
4-[4-(3,4-dimethoxyphenyl)phenyl]-2,5-dimethyl-1,3-thiazole (PubChem CID 134147536) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is 4-[4-(3,4-dimethoxyphenyl)phenyl]-2,5-dimethyl-1,3-thiazole.
| Compound Name | 4-[4-(3,4-dimethoxyphenyl)phenyl]-2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 134147536 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-[4-(3,4-dimethoxyphenyl)phenyl]-2,5-dimethyl-1,3-thiazole |
| SMILES | COc1ccc(-c2ccc(-c3nc(C)sc3C)cc2)cc1OC |
| InChI | InChI=1S/C19H19NO2S/c1-12-19(20-13(2)23-12)15-7-5-14(6-8-15)16-9-10-17(21-3)18(11-16)22-4/h5-11H,1-4H3 |
| InChIKey | UDHOBLUOVHCOIB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |