C22H35NO — CID 134147575
(3R,8R,9S,10S,13S,14S,17E)-17-ethylidene-10,13-dimethyl-3-(methylamino)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one (PubChem CID 134147575) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S,17E)-17-ethylidene-10,13-dimethyl-3-(methylamino)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one.
| Compound Name | (3R,8R,9S,10S,13S,14S,17E)-17-ethylidene-10,13-dimethyl-3-(methylamino)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 134147575 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S,17E)-17-ethylidene-10,13-dimethyl-3-(methylamino)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
| SMILES | C/C=C1/C(=O)C[C@H]2[C@@H]3CCC4C[C@H](NC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H35NO/c1-5-17-20(24)13-19-16-7-6-14-12-15(23-4)8-10-21(14,2)18(16)9-11-22(17,19)3/h5,14-16,18-19,23H,6-13H2,1-4H3/b17-5-/t14?,15-,16-,18+,19+,21+,22-/m1/s1 |
| InChIKey | UEXMYUKBZWZWNP-OWYOUJQISA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|