C14H13NO4 — CID 134147775
methyl 6-[(S)-hydroxy(phenyl)methyl]-4-oxo-1H-pyridine-3-carboxylate (PubChem CID 134147775) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is methyl 6-[(S)-hydroxy(phenyl)methyl]-4-oxo-1H-pyridine-3-carboxylate.
| Compound Name | methyl 6-[(S)-hydroxy(phenyl)methyl]-4-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134147775 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | methyl 6-[(S)-hydroxy(phenyl)methyl]-4-oxo-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c[nH]c([C@@H](O)c2ccccc2)cc1=O |
| InChI | InChI=1S/C14H13NO4/c1-19-14(18)10-8-15-11(7-12(10)16)13(17)9-5-3-2-4-6-9/h2-8,13,17H,1H3,(H,15,16)/t13-/m0/s1 |
| InChIKey | QDYHUYQVPSMWIF-ZDUSSCGKSA-N |
| XLogP | 1.24 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |