C15H18N4O2 — CID 134148063
ethyl 13-amino-3-methyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate (PubChem CID 134148063) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is ethyl 13-amino-3-methyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate.
| Compound Name | ethyl 13-amino-3-methyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 134148063 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 13-amino-3-methyl-3,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1C)-c1nc(N)ncc1CCC2 |
| InChI | InChI=1S/C15H18N4O2/c1-3-21-14(20)11-7-9-5-4-6-10-8-17-15(16)18-12(10)13(9)19(11)2/h7-8H,3-6H2,1-2H3,(H2,16,17,18) |
| InChIKey | LDKRVQFJXJTLAF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |