About 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole
2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole (PubChem CID 134148236) has the molecular formula C18H14F3NS
and a molecular weight of 333.38 g/mol. Its IUPAC name is 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole |
| PubChem CID | 134148236 |
| Molecular Formula | C18H14F3NS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)c(C)s1 |
| InChI | InChI=1S/C18H14F3NS/c1-11-17(22-12(2)23-11)15-5-3-13(4-6-15)14-7-9-16(10-8-14)18(19,20)21/h3-10H,1-2H3 |
| InChIKey | QYHJLKUWAIGCBN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole?
The IUPAC name of 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole (CID 134148236) is 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole.
What is the SMILES notation for 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole?
The canonical SMILES for 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole is Cc1nc(-c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)c(C)s1.
What is the InChIKey of 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole?
The InChIKey is QYHJLKUWAIGCBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3NS/c1-11-17(22-12(2)23-11)15-5-3-13(4-6-15)14-7-9-16(10-8-14)18(19,20)21/h3-10H,1-2H3.
What are the key properties of 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole?
2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole has a molecular weight of 333.38 g/mol, XLogP of 6.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole is sourced from PubChem (CID 134148236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).