C26H22FN3O — CID 134148653
17-(4-fluorophenyl)-15-phenyl-11-oxa-13,14-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,8,12,15-pentaen-2-amine (PubChem CID 134148653) has the molecular formula C26H22FN3O and a molecular weight of 411.48 g/mol. Its IUPAC name is 17-(4-fluorophenyl)-15-phenyl-11-oxa-13,14-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,8,12,15-pentaen-2-amine.
| Compound Name | 17-(4-fluorophenyl)-15-phenyl-11-oxa-13,14-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,8,12,15-pentaen-2-amine |
|---|---|
| PubChem CID | 134148653 |
| Molecular Formula | C26H22FN3O |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 17-(4-fluorophenyl)-15-phenyl-11-oxa-13,14-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,8,12,15-pentaen-2-amine |
| SMILES | Nc1c2c(cc3c1C(c1ccc(F)cc1)c1c(n[nH]c1-c1ccccc1)O3)CCCC2 |
| InChI | InChI=1S/C26H22FN3O/c27-18-12-10-15(11-13-18)21-22-20(14-17-8-4-5-9-19(17)24(22)28)31-26-23(21)25(29-30-26)16-6-2-1-3-7-16/h1-3,6-7,10-14,21H,4-5,8-9,28H2,(H,29,30) |
| InChIKey | OETCXUOEVYMOGV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|