C19H30O4 — CID 134148916
(1R,2R,3S,4R,5S,6S,9S,12R)-12-[(2R)-hexan-2-yl]-3,4-dihydroxy-1,5-dimethyl-11-oxatricyclo[7.2.1.02,6]dodec-7-en-10-one (PubChem CID 134148916) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S,6S,9S,12R)-12-[(2R)-hexan-2-yl]-3,4-dihydroxy-1,5-dimethyl-11-oxatricyclo[7.2.1.02,6]dodec-7-en-10-one.
| Compound Name | (1R,2R,3S,4R,5S,6S,9S,12R)-12-[(2R)-hexan-2-yl]-3,4-dihydroxy-1,5-dimethyl-11-oxatricyclo[7.2.1.02,6]dodec-7-en-10-one |
|---|---|
| PubChem CID | 134148916 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (1R,2R,3S,4R,5S,6S,9S,12R)-12-[(2R)-hexan-2-yl]-3,4-dihydroxy-1,5-dimethyl-11-oxatricyclo[7.2.1.02,6]dodec-7-en-10-one |
| SMILES | CCCC[C@@H](C)[C@@H]1[C@@H]2C=C[C@H]3[C@H](C)[C@@H](O)[C@@H](O)[C@@H]3[C@]1(C)OC2=O |
| InChI | InChI=1S/C19H30O4/c1-5-6-7-10(2)14-13-9-8-12-11(3)16(20)17(21)15(12)19(14,4)23-18(13)22/h8-17,20-21H,5-7H2,1-4H3/t10-,11+,12+,13+,14-,15-,16-,17+,19-/m1/s1 |
| InChIKey | BTXBETBEKXAOJM-OFJPSDSPSA-N |
| XLogP | 2.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|