C28H40N8O2S — CID 134148939
2-[3-[(3R,6S,9aS)-6-[4-(diaminomethylideneamino)butyl]-8-(2-naphthalen-2-ylethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-b][1,3]thiazin-3-yl]propyl]guanidine (PubChem CID 134148939) has the molecular formula C28H40N8O2S and a molecular weight of 552.75 g/mol. Its IUPAC name is 2-[3-[(3R,6S,9aS)-6-[4-(diaminomethylideneamino)butyl]-8-(2-naphthalen-2-ylethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-b][1,3]thiazin-3-yl]propyl]guanidine.
| Compound Name | 2-[3-[(3R,6S,9aS)-6-[4-(diaminomethylideneamino)butyl]-8-(2-naphthalen-2-ylethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-b][1,3]thiazin-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 134148939 |
| Molecular Formula | C28H40N8O2S |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 2-[3-[(3R,6S,9aS)-6-[4-(diaminomethylideneamino)butyl]-8-(2-naphthalen-2-ylethyl)-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[2,1-b][1,3]thiazin-3-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCC[C@H]1C(=O)N(CCc2ccc3ccccc3c2)C[C@@H]2SC[C@H](CCCN=C(N)N)C(=O)N21 |
| InChI | InChI=1S/C28H40N8O2S/c29-27(30)33-13-4-3-9-23-26(38)35(15-12-19-10-11-20-6-1-2-7-21(20)16-19)17-24-36(23)25(37)22(18-39-24)8-5-14-34-28(31)32/h1-2,6-7,10-11,16,22-24H,3-5,8-9,12-15,17-18H2,(H4,29,30,33)(H4,31,32,34)/t22-,23-,24-/m0/s1 |
| InChIKey | UEMPXCVRPBVHGP-HJOGWXRNSA-N |
| XLogP | 1.61 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|