C26H22F6N4O3S — CID 134148959
N-[[1-(2,5-dimethylphenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide (PubChem CID 134148959) has the molecular formula C26H22F6N4O3S and a molecular weight of 584.54 g/mol. Its IUPAC name is N-[[1-(2,5-dimethylphenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[[1-(2,5-dimethylphenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134148959 |
| Molecular Formula | C26H22F6N4O3S |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | N-[[1-(2,5-dimethylphenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(-n2cc(CN(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)S(=O)(=O)c3ccccc3)nn2)c1 |
| InChI | InChI=1S/C26H22F6N4O3S/c1-17-8-9-18(2)23(14-17)35-15-20(33-34-35)16-36(40(38,39)22-6-4-3-5-7-22)21-12-10-19(11-13-21)24(37,25(27,28)29)26(30,31)32/h3-15,37H,16H2,1-2H3 |
| InChIKey | RYKGRZSZTFYQBI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |