C20H22N2O2 — CID 134149355
7-(1,3-benzodioxol-5-ylmethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline (PubChem CID 134149355) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-ylmethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline.
| Compound Name | 7-(1,3-benzodioxol-5-ylmethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline |
|---|---|
| PubChem CID | 134149355 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 7-(1,3-benzodioxol-5-ylmethyl)-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoline |
| SMILES | c1cc(Cc2ccc3c(c2)OCO3)c2c(c1)N1CCNCC1CC2 |
| InChI | InChI=1S/C20H22N2O2/c1-2-15(10-14-4-7-19-20(11-14)24-13-23-19)17-6-5-16-12-21-8-9-22(16)18(17)3-1/h1-4,7,11,16,21H,5-6,8-10,12-13H2 |
| InChIKey | MYUNZXXMZICHEZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |