C24H16F8N4O3S — CID 134149508
N-[[1-(2,6-difluorophenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide (PubChem CID 134149508) has the molecular formula C24H16F8N4O3S and a molecular weight of 592.47 g/mol. Its IUPAC name is N-[[1-(2,6-difluorophenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[[1-(2,6-difluorophenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134149508 |
| Molecular Formula | C24H16F8N4O3S |
| Molecular Weight | 592.47 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | N-[[1-(2,6-difluorophenyl)triazol-4-yl]methyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(Cc1cn(-c2c(F)cccc2F)nn1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H16F8N4O3S/c25-19-7-4-8-20(26)21(19)35-13-16(33-34-35)14-36(40(38,39)18-5-2-1-3-6-18)17-11-9-15(10-12-17)22(37,23(27,28)29)24(30,31)32/h1-13,37H,14H2 |
| InChIKey | VUIFBXUDXIYXCO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |