C10H15NO5 — CID 134149590
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(1H-pyrrol-2-yl)oxane-3,4,5-triol (PubChem CID 134149590) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(1H-pyrrol-2-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(1H-pyrrol-2-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134149590 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(1H-pyrrol-2-yl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc[nH]2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H15NO5/c12-4-6-7(13)8(14)9(15)10(16-6)5-2-1-3-11-5/h1-3,6-15H,4H2/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | PADPYMJQCPJDGX-SPFKKGSWSA-N |
| XLogP | -1.47 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |