C24H40O3 — CID 134149961
(2S,3S,5R,6R)-2-hydroxy-2,5-dimethyl-6-[(2S)-2-methylbutanoyl]-3-(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)cyclohexan-1-one (PubChem CID 134149961) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is (2S,3S,5R,6R)-2-hydroxy-2,5-dimethyl-6-[(2S)-2-methylbutanoyl]-3-(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)cyclohexan-1-one.
| Compound Name | (2S,3S,5R,6R)-2-hydroxy-2,5-dimethyl-6-[(2S)-2-methylbutanoyl]-3-(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 134149961 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | (2S,3S,5R,6R)-2-hydroxy-2,5-dimethyl-6-[(2S)-2-methylbutanoyl]-3-(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)cyclohexan-1-one |
| SMILES | CC[C@H](C)C(=O)[C@@H]1C(=O)[C@@](C)(O)[C@@H](CC=C(C)C)C[C@@]1(C)CCC=C(C)C |
| InChI | InChI=1S/C24H40O3/c1-9-18(6)21(25)20-22(26)24(8,27)19(13-12-17(4)5)15-23(20,7)14-10-11-16(2)3/h11-12,18-20,27H,9-10,13-15H2,1-8H3/t18-,19-,20+,23+,24-/m0/s1 |
| InChIKey | RYLFKWDBVOTJDY-OMDOPDFPSA-N |
| XLogP | 5.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|