C37H42ClN3O4 — CID 134150013
16-[(1-decylbenzimidazol-2-yl)methoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride (PubChem CID 134150013) has the molecular formula C37H42ClN3O4 and a molecular weight of 628.21 g/mol. Its IUPAC name is 16-[(1-decylbenzimidazol-2-yl)methoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride.
| Compound Name | 16-[(1-decylbenzimidazol-2-yl)methoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
|---|---|
| PubChem CID | 134150013 |
| Molecular Formula | C37H42ClN3O4 |
| Molecular Weight | 628.21 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | 16-[(1-decylbenzimidazol-2-yl)methoxy]-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
| SMILES | CCCCCCCCCCn1c(COc2c(OC)ccc3cc4[n+](cc23)CCc2cc3c(cc2-4)OCO3)nc2ccccc21.[Cl-] |
| InChI | InChI=1S/C37H42N3O4.ClH/c1-3-4-5-6-7-8-9-12-18-40-31-14-11-10-13-30(31)38-36(40)24-42-37-29-23-39-19-17-27-21-34-35(44-25-43-34)22-28(27)32(39)20-26(29)15-16-33(37)41-2;/h10-11,13-16,20-23H,3-9,12,17-19,24-25H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YTKZODQRSZZZKT-UHFFFAOYSA-M |
| XLogP | 5.16 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.21 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|