C17H19FN2O4 — CID 134150601
4-(4-fluorophenyl)-N'-[(2,3,4-trihydroxyphenyl)methyl]butanehydrazide (PubChem CID 134150601) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(2,3,4-trihydroxyphenyl)methyl]butanehydrazide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(2,3,4-trihydroxyphenyl)methyl]butanehydrazide |
|---|---|
| PubChem CID | 134150601 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(2,3,4-trihydroxyphenyl)methyl]butanehydrazide |
| SMILES | O=C(CCCc1ccc(F)cc1)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C17H19FN2O4/c18-13-7-4-11(5-8-13)2-1-3-15(22)20-19-10-12-6-9-14(21)17(24)16(12)23/h4-9,19,21,23-24H,1-3,10H2,(H,20,22) |
| InChIKey | ZGJRSKNKWWSLSJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|