About N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine
N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine (PubChem CID 134150619) has the molecular formula C14H9F2NO2S
and a molecular weight of 293.29 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine.
Molecular Properties
| Compound Name | N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine |
| PubChem CID | 134150619 |
| Molecular Formula | C14H9F2NO2S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine |
| SMILES | O=S1(=O)C=Cc2ccc(Nc3ccc(F)c(F)c3)cc21 |
| InChI | InChI=1S/C14H9F2NO2S/c15-12-4-3-10(7-13(12)16)17-11-2-1-9-5-6-20(18,19)14(9)8-11/h1-8,17H |
| InChIKey | SJIXCBVIENECTM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine?
The IUPAC name of N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine (CID 134150619) is N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine.
What is the SMILES notation for N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine?
The canonical SMILES for N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine is O=S1(=O)C=Cc2ccc(Nc3ccc(F)c(F)c3)cc21.
What is the InChIKey of N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine?
The InChIKey is SJIXCBVIENECTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F2NO2S/c15-12-4-3-10(7-13(12)16)17-11-2-1-9-5-6-20(18,19)14(9)8-11/h1-8,17H.
What are the key properties of N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine?
N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine has a molecular weight of 293.29 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-difluorophenyl)-1,1-dioxo-1-benzothiophen-6-amine is sourced from PubChem (CID 134150619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).