C21H29NO6S — CID 134150721
ethyl (2S,3aS,4S,8aS)-4-acetyloxy-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylate (PubChem CID 134150721) has the molecular formula C21H29NO6S and a molecular weight of 423.53 g/mol. Its IUPAC name is ethyl (2S,3aS,4S,8aS)-4-acetyloxy-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2S,3aS,4S,8aS)-4-acetyloxy-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134150721 |
| Molecular Formula | C21H29NO6S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | ethyl (2S,3aS,4S,8aS)-4-acetyloxy-1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2[C@@H](OC(C)=O)CCCC[C@@H]2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H29NO6S/c1-4-27-21(24)19-13-17-18(7-5-6-8-20(17)28-15(3)23)22(19)29(25,26)16-11-9-14(2)10-12-16/h9-12,17-20H,4-8,13H2,1-3H3/t17-,18-,19-,20-/m0/s1 |
| InChIKey | AZTJVKFRGNJGSS-MUGJNUQGSA-N |
| XLogP | 2.81 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |