C29H29NO8 — CID 134150840
3-(3,4-dimethoxyphenyl)-4-(3-methoxyphenyl)-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrole-2,5-dione (PubChem CID 134150840) has the molecular formula C29H29NO8 and a molecular weight of 519.55 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-(3-methoxyphenyl)-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-(3-methoxyphenyl)-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 134150840 |
| Molecular Formula | C29H29NO8 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-(3-methoxyphenyl)-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrole-2,5-dione |
| SMILES | COc1cccc(C2=C(c3ccc(OC)c(OC)c3)C(=O)N(Cc3cc(OC)c(OC)c(OC)c3)C2=O)c1 |
| InChI | InChI=1S/C29H29NO8/c1-33-20-9-7-8-18(14-20)25-26(19-10-11-21(34-2)22(15-19)35-3)29(32)30(28(25)31)16-17-12-23(36-4)27(38-6)24(13-17)37-5/h7-15H,16H2,1-6H3 |
| InChIKey | MTCFYQDAYJBOEI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|