C17H11Cl2N3O4 — CID 134150915
N-(3,4-dichlorophenyl)-2,4,6-trioxo-1-phenyl-1,3-diazinane-5-carboxamide (PubChem CID 134150915) has the molecular formula C17H11Cl2N3O4 and a molecular weight of 392.20 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2,4,6-trioxo-1-phenyl-1,3-diazinane-5-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-2,4,6-trioxo-1-phenyl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 134150915 |
| Molecular Formula | C17H11Cl2N3O4 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2,4,6-trioxo-1-phenyl-1,3-diazinane-5-carboxamide |
| SMILES | O=C1NC(=O)N(c2ccccc2)C(=O)C1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2N3O4/c18-11-7-6-9(8-12(11)19)20-14(23)13-15(24)21-17(26)22(16(13)25)10-4-2-1-3-5-10/h1-8,13H,(H,20,23)(H,21,24,26) |
| InChIKey | NREHNTHCACQXNW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|