C18H30N4O7 — CID 134150946
(6R,15S,18S)-6-amino-6-methyl-2,5,17-trioxo-8,13-dioxa-1,4,16-triazabicyclo[16.3.0]henicosane-15-carboxylic acid (PubChem CID 134150946) has the molecular formula C18H30N4O7 and a molecular weight of 414.46 g/mol. Its IUPAC name is (6R,15S,18S)-6-amino-6-methyl-2,5,17-trioxo-8,13-dioxa-1,4,16-triazabicyclo[16.3.0]henicosane-15-carboxylic acid.
| Compound Name | (6R,15S,18S)-6-amino-6-methyl-2,5,17-trioxo-8,13-dioxa-1,4,16-triazabicyclo[16.3.0]henicosane-15-carboxylic acid |
|---|---|
| PubChem CID | 134150946 |
| Molecular Formula | C18H30N4O7 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (6R,15S,18S)-6-amino-6-methyl-2,5,17-trioxo-8,13-dioxa-1,4,16-triazabicyclo[16.3.0]henicosane-15-carboxylic acid |
| SMILES | C[C@@]1(N)COCCCCOC[C@@H](C(=O)O)NC(=O)[C@@H]2CCCN2C(=O)CNC1=O |
| InChI | InChI=1S/C18H30N4O7/c1-18(19)11-29-8-3-2-7-28-10-12(16(25)26)21-15(24)13-5-4-6-22(13)14(23)9-20-17(18)27/h12-13H,2-11,19H2,1H3,(H,20,27)(H,21,24)(H,25,26)/t12-,13-,18+/m0/s1 |
| InChIKey | CGDMBVIRDXHBBS-ZJNRKIDTSA-N |
| XLogP | -1.79 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |