C24H29N5O2 — CID 134151065
ethyl 2-[1-[(4-carbamimidoylphenyl)methyl]-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazol-8-yl]-2-methylpropanoate (PubChem CID 134151065) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is ethyl 2-[1-[(4-carbamimidoylphenyl)methyl]-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazol-8-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[1-[(4-carbamimidoylphenyl)methyl]-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazol-8-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 134151065 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | ethyl 2-[1-[(4-carbamimidoylphenyl)methyl]-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazol-8-yl]-2-methylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(CC2NCCn3c2nc2cc(C(C)(C)C(=O)OCC)ccc23)cc1 |
| InChI | InChI=1S/C24H29N5O2/c1-4-31-23(30)24(2,3)17-9-10-20-18(14-17)28-22-19(27-11-12-29(20)22)13-15-5-7-16(8-6-15)21(25)26/h5-10,14,19,27H,4,11-13H2,1-3H3,(H3,25,26) |
| InChIKey | PHRVUKVPNAEALL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|